C25H24O4 — CID 134200774
[2-(2-hydroxyethoxy)-5-(4-phenylphenyl)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 134200774) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is [2-(2-hydroxyethoxy)-5-(4-phenylphenyl)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [2-(2-hydroxyethoxy)-5-(4-phenylphenyl)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134200774 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [2-(2-hydroxyethoxy)-5-(4-phenylphenyl)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(-c3ccccc3)cc2)ccc1OCCO |
| InChI | InChI=1S/C25H24O4/c1-18(2)25(27)29-17-23-16-22(12-13-24(23)28-15-14-26)21-10-8-20(9-11-21)19-6-4-3-5-7-19/h3-13,16,26H,1,14-15,17H2,2H3 |
| InChIKey | DMRFCHYAUQKFHN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|