C34H39FO5 — CID 145122332
[5-[2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]-2-[2-(2-hydroxyethoxy)ethoxy]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 145122332) has the molecular formula C34H39FO5 and a molecular weight of 546.68 g/mol. Its IUPAC name is [5-[2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]-2-[2-(2-hydroxyethoxy)ethoxy]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-[2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]-2-[2-(2-hydroxyethoxy)ethoxy]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145122332 |
| Molecular Formula | C34H39FO5 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | [5-[2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]-2-[2-(2-hydroxyethoxy)ethoxy]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(-c3ccc(C4CCC(C)CC4)cc3)cc2F)ccc1OCCOCCO |
| InChI | InChI=1S/C34H39FO5/c1-23(2)34(37)40-22-30-20-29(13-15-33(30)39-19-18-38-17-16-36)31-14-12-28(21-32(31)35)27-10-8-26(9-11-27)25-6-4-24(3)5-7-25/h8-15,20-21,24-25,36H,1,4-7,16-19,22H2,2-3H3 |
| InChIKey | NTCDCBCOPRGXPJ-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|