C27H33FO4 — CID 134200643
3-[5-(4-cyclohexyl-2-fluorophenyl)-2-(2-hydroxyethoxy)phenyl]propyl 2-methylprop-2-enoate (PubChem CID 134200643) has the molecular formula C27H33FO4 and a molecular weight of 440.56 g/mol. Its IUPAC name is 3-[5-(4-cyclohexyl-2-fluorophenyl)-2-(2-hydroxyethoxy)phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-(4-cyclohexyl-2-fluorophenyl)-2-(2-hydroxyethoxy)phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134200643 |
| Molecular Formula | C27H33FO4 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 3-[5-(4-cyclohexyl-2-fluorophenyl)-2-(2-hydroxyethoxy)phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(C3CCCCC3)cc2F)ccc1OCCO |
| InChI | InChI=1S/C27H33FO4/c1-19(2)27(30)32-15-6-9-23-17-22(11-13-26(23)31-16-14-29)24-12-10-21(18-25(24)28)20-7-4-3-5-8-20/h10-13,17-18,20,29H,1,3-9,14-16H2,2H3 |
| InChIKey | BSPHZBGBMMGQSL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|