C40H55FO6 — CID 155156211
[2-[[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-2-[3-(3-methylbuta-1,3-dien-2-yloxy)propyl]phenoxy]methyl]-3-hydroxy-2-(hydroxymethyl)propyl] 2-methylprop-2-enoate (PubChem CID 155156211) has the molecular formula C40H55FO6 and a molecular weight of 650.87 g/mol. Its IUPAC name is [2-[[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-2-[3-(3-methylbuta-1,3-dien-2-yloxy)propyl]phenoxy]methyl]-3-hydroxy-2-(hydroxymethyl)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-2-[3-(3-methylbuta-1,3-dien-2-yloxy)propyl]phenoxy]methyl]-3-hydroxy-2-(hydroxymethyl)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155156211 |
| Molecular Formula | C40H55FO6 |
| Molecular Weight | 650.87 g/mol |
| Exact Mass | 650.40 |
| IUPAC Name | [2-[[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-2-[3-(3-methylbuta-1,3-dien-2-yloxy)propyl]phenoxy]methyl]-3-hydroxy-2-(hydroxymethyl)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=C)OCCCc1cc(-c2ccc(C3CCC(CCCCC)CC3)cc2F)ccc1OCC(CO)(CO)COC(=O)C(=C)C |
| InChI | InChI=1S/C40H55FO6/c1-7-8-9-11-31-13-15-32(16-14-31)33-17-19-36(37(41)23-33)34-18-20-38(35(22-34)12-10-21-45-30(6)28(2)3)46-26-40(24-42,25-43)27-47-39(44)29(4)5/h17-20,22-23,31-32,42-43H,2,4,6-16,21,24-27H2,1,3,5H3 |
| InChIKey | VTYBLOBSLBIMQA-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.87 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|