C46H67FN4O3 — CID 155300566
3-[2-[3-amino-2,2-bis(aminomethyl)propoxy]-5-[2-(3-aminopropyl)-5-ethyl-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 155300566) has the molecular formula C46H67FN4O3 and a molecular weight of 743.06 g/mol. Its IUPAC name is 3-[2-[3-amino-2,2-bis(aminomethyl)propoxy]-5-[2-(3-aminopropyl)-5-ethyl-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[3-amino-2,2-bis(aminomethyl)propoxy]-5-[2-(3-aminopropyl)-5-ethyl-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155300566 |
| Molecular Formula | C46H67FN4O3 |
| Molecular Weight | 743.06 g/mol |
| Exact Mass | 742.52 |
| IUPAC Name | 3-[2-[3-amino-2,2-bis(aminomethyl)propoxy]-5-[2-(3-aminopropyl)-5-ethyl-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2cc(CC)c(-c3ccc(C4CCC(CCCCC)CC4)cc3F)cc2CCCN)ccc1OCC(CN)(CN)CN |
| InChI | InChI=1S/C46H67FN4O3/c1-5-7-8-11-33-14-16-35(17-15-33)36-18-20-40(43(47)27-36)42-26-37(12-9-22-48)41(25-34(42)6-2)38-19-21-44(54-31-46(28-49,29-50)30-51)39(24-38)13-10-23-53-45(52)32(3)4/h18-21,24-27,33,35H,3,5-17,22-23,28-31,48-51H2,1-2,4H3 |
| InChIKey | FQAOLPOCWZXZIC-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.06 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|