C33H37FO3 — CID 145121894
2-[2-[2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]-5-(2-hydroxyethyl)phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 145121894) has the molecular formula C33H37FO3 and a molecular weight of 500.65 g/mol. Its IUPAC name is 2-[2-[2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]-5-(2-hydroxyethyl)phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]-5-(2-hydroxyethyl)phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145121894 |
| Molecular Formula | C33H37FO3 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 2-[2-[2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]phenyl]-5-(2-hydroxyethyl)phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(CCO)ccc1-c1ccc(-c2ccc(C3CCC(C)CC3)cc2)cc1F |
| InChI | InChI=1S/C33H37FO3/c1-22(2)33(36)37-19-17-29-20-24(16-18-35)6-14-30(29)31-15-13-28(21-32(31)34)27-11-9-26(10-12-27)25-7-4-23(3)5-8-25/h6,9-15,20-21,23,25,35H,1,4-5,7-8,16-19H2,2-3H3 |
| InChIKey | BHVOTWNNGRYINE-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|