C37H46O3 — CID 134193830
2-[5-(hydroxymethyl)-2-[2-methyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 134193830) has the molecular formula C37H46O3 and a molecular weight of 538.77 g/mol. Its IUPAC name is 2-[5-(hydroxymethyl)-2-[2-methyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-(hydroxymethyl)-2-[2-methyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193830 |
| Molecular Formula | C37H46O3 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | 2-[5-(hydroxymethyl)-2-[2-methyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(CO)ccc1-c1ccc(-c2ccc(C3CCC(CCCCC)CC3)cc2)cc1C |
| InChI | InChI=1S/C37H46O3/c1-5-6-7-8-28-9-12-30(13-10-28)31-14-16-32(17-15-31)33-18-20-35(27(4)23-33)36-19-11-29(25-38)24-34(36)21-22-40-37(39)26(2)3/h11,14-20,23-24,28,30,38H,2,5-10,12-13,21-22,25H2,1,3-4H3 |
| InChIKey | KDHHZEIWESKLSP-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|