C40H56O7 — CID 134193629
2-[2-(4-hydroxybutyl)-5-[2-methyl-4-(4-pentylcyclohexyl)phenyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 134193629) has the molecular formula C40H56O7 and a molecular weight of 648.88 g/mol. Its IUPAC name is 2-[2-(4-hydroxybutyl)-5-[2-methyl-4-(4-pentylcyclohexyl)phenyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(4-hydroxybutyl)-5-[2-methyl-4-(4-pentylcyclohexyl)phenyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193629 |
| Molecular Formula | C40H56O7 |
| Molecular Weight | 648.88 g/mol |
| Exact Mass | 648.40 |
| IUPAC Name | 2-[2-(4-hydroxybutyl)-5-[2-methyl-4-(4-pentylcyclohexyl)phenyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(-c2ccc(C3CCC(CCCCC)CC3)cc2C)c(OCCOC(=O)C(=C)C)cc1CCCCO |
| InChI | InChI=1S/C40H56O7/c1-7-8-9-12-31-14-16-32(17-15-31)33-18-19-35(30(6)25-33)36-27-37(44-21-23-46-39(42)28(2)3)34(13-10-11-20-41)26-38(36)45-22-24-47-40(43)29(4)5/h18-19,25-27,31-32,41H,2,4,7-17,20-24H2,1,3,5-6H3 |
| InChIKey | AXBGHXFQUHUUJG-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.88 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|