C47H68O6 — CID 134526949
3-[5-[2-ethyl-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-(2-hydroxyethoxy)-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 134526949) has the molecular formula C47H68O6 and a molecular weight of 729.05 g/mol. Its IUPAC name is 3-[5-[2-ethyl-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-(2-hydroxyethoxy)-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-[2-ethyl-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-(2-hydroxyethoxy)-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134526949 |
| Molecular Formula | C47H68O6 |
| Molecular Weight | 729.05 g/mol |
| Exact Mass | 728.50 |
| IUPAC Name | 3-[5-[2-ethyl-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-(2-hydroxyethoxy)-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(C3CCC(C4CCC(CCCCC)CC4)CC3)cc2CC)cc(CCCOC(=O)C(=C)C)c1OCCO |
| InChI | InChI=1S/C47H68O6/c1-7-9-10-13-35-16-18-37(19-17-35)38-20-22-39(23-21-38)40-24-25-44(36(8-2)30-40)43-31-41(14-11-27-52-46(49)33(3)4)45(51-29-26-48)42(32-43)15-12-28-53-47(50)34(5)6/h24-25,30-32,35,37-39,48H,3,5,7-23,26-29H2,1-2,4,6H3 |
| InChIKey | BKEKSRHVWFANPQ-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.05 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|