C47H66O7 — CID 155300260
3-[2-[3,5-dihydroxy-4-(hydroxymethyl)pentoxy]-5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-3-(3-hydroxypropyl)phenyl]propyl 2-methylprop-2-enoate (PubChem CID 155300260) has the molecular formula C47H66O7 and a molecular weight of 743.04 g/mol. Its IUPAC name is 3-[2-[3,5-dihydroxy-4-(hydroxymethyl)pentoxy]-5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-3-(3-hydroxypropyl)phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[3,5-dihydroxy-4-(hydroxymethyl)pentoxy]-5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-3-(3-hydroxypropyl)phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155300260 |
| Molecular Formula | C47H66O7 |
| Molecular Weight | 743.04 g/mol |
| Exact Mass | 742.48 |
| IUPAC Name | 3-[2-[3,5-dihydroxy-4-(hydroxymethyl)pentoxy]-5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-3-(3-hydroxypropyl)phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3)cc2CC)cc(CCCO)c1OCCC(O)C(CO)CO |
| InChI | InChI=1S/C47H66O7/c1-5-7-8-11-34-14-16-36(17-15-34)37-18-20-38(21-19-37)39-22-23-44(35(6-2)28-39)42-29-40(12-9-25-48)46(53-27-24-45(51)43(31-49)32-50)41(30-42)13-10-26-54-47(52)33(3)4/h18-23,28-30,34,36,43,45,48-51H,3,5-17,24-27,31-32H2,1-2,4H3 |
| InChIKey | GJEVALJCYPMUBW-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.04 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|