C56H80O7 — CID 170070533
3-[2-[3,3-bis(hydroxymethyl)octoxy]-5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 3-methylbut-3-enoate (PubChem CID 170070533) has the molecular formula C56H80O7 and a molecular weight of 865.25 g/mol. Its IUPAC name is 3-[2-[3,3-bis(hydroxymethyl)octoxy]-5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 3-methylbut-3-enoate.
| Compound Name | 3-[2-[3,3-bis(hydroxymethyl)octoxy]-5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 3-methylbut-3-enoate |
|---|---|
| PubChem CID | 170070533 |
| Molecular Formula | C56H80O7 |
| Molecular Weight | 865.25 g/mol |
| Exact Mass | 864.59 |
| IUPAC Name | 3-[2-[3,3-bis(hydroxymethyl)octoxy]-5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 3-methylbut-3-enoate |
| SMILES | C=C(C)CC(=O)OCCCc1cc(-c2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3)cc2CC)cc(CCCOC(=O)C(=C)C)c1OCCC(CO)(CO)CCCCC |
| InChI | InChI=1S/C56H80O7/c1-8-11-13-17-43-20-22-45(23-21-43)46-24-26-47(27-25-46)48-28-29-52(44(10-3)36-48)51-37-49(18-15-32-61-53(59)35-41(4)5)54(50(38-51)19-16-33-63-55(60)42(6)7)62-34-31-56(39-57,40-58)30-14-12-9-2/h24-29,36-38,43,45,57-58H,4,6,8-23,30-35,39-40H2,1-3,5,7H3 |
| InChIKey | CQBPQYKWNJBYFC-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.25 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|