C50H82O7 — CID 155200228
3-[2-[3,3-bis(hydroxymethyl)hexoxy]-3-[3-(2-methylprop-2-enoyloxy)propyl]-5-[4-(4-nonylcyclohexyl)cyclohexyl]phenyl]propyl 3-methylbut-3-enoate (PubChem CID 155200228) has the molecular formula C50H82O7 and a molecular weight of 795.20 g/mol. Its IUPAC name is 3-[2-[3,3-bis(hydroxymethyl)hexoxy]-3-[3-(2-methylprop-2-enoyloxy)propyl]-5-[4-(4-nonylcyclohexyl)cyclohexyl]phenyl]propyl 3-methylbut-3-enoate.
| Compound Name | 3-[2-[3,3-bis(hydroxymethyl)hexoxy]-3-[3-(2-methylprop-2-enoyloxy)propyl]-5-[4-(4-nonylcyclohexyl)cyclohexyl]phenyl]propyl 3-methylbut-3-enoate |
|---|---|
| PubChem CID | 155200228 |
| Molecular Formula | C50H82O7 |
| Molecular Weight | 795.20 g/mol |
| Exact Mass | 794.61 |
| IUPAC Name | 3-[2-[3,3-bis(hydroxymethyl)hexoxy]-3-[3-(2-methylprop-2-enoyloxy)propyl]-5-[4-(4-nonylcyclohexyl)cyclohexyl]phenyl]propyl 3-methylbut-3-enoate |
| SMILES | C=C(C)CC(=O)OCCCc1cc(C2CCC(C3CCC(CCCCCCCCC)CC3)CC2)cc(CCCOC(=O)C(=C)C)c1OCCC(CO)(CO)CCC |
| InChI | InChI=1S/C50H82O7/c1-7-9-10-11-12-13-14-17-40-20-22-41(23-21-40)42-24-26-43(27-25-42)46-34-44(18-15-30-55-47(53)33-38(3)4)48(56-32-29-50(36-51,37-52)28-8-2)45(35-46)19-16-31-57-49(54)39(5)6/h34-35,40-43,51-52H,3,5,7-33,36-37H2,1-2,4,6H3 |
| InChIKey | AJFCFTGCINQPGT-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.20 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|