C46H64O5 — CID 126701622
3-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 126701622) has the molecular formula C46H64O5 and a molecular weight of 697.01 g/mol. Its IUPAC name is 3-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126701622 |
| Molecular Formula | C46H64O5 |
| Molecular Weight | 697.01 g/mol |
| Exact Mass | 696.48 |
| IUPAC Name | 3-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3)cc2CC)ccc1OCCC(CO)(CO)CCC |
| InChI | InChI=1S/C46H64O5/c1-6-9-10-12-35-14-16-37(17-15-35)38-18-20-39(21-19-38)40-22-24-43(36(8-3)30-40)41-23-25-44(50-29-27-46(32-47,33-48)26-7-2)42(31-41)13-11-28-51-45(49)34(4)5/h18-25,30-31,35,37,47-48H,4,6-17,26-29,32-33H2,1-3,5H3 |
| InChIKey | CLJATTUHYIVUGN-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.01 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|