C44H60O5 — CID 138735553
3-[2-[3,3-bis(hydroxymethyl)octoxy]-5-[2-ethyl-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 138735553) has the molecular formula C44H60O5 and a molecular weight of 668.96 g/mol. Its IUPAC name is 3-[2-[3,3-bis(hydroxymethyl)octoxy]-5-[2-ethyl-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[3,3-bis(hydroxymethyl)octoxy]-5-[2-ethyl-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138735553 |
| Molecular Formula | C44H60O5 |
| Molecular Weight | 668.96 g/mol |
| Exact Mass | 668.44 |
| IUPAC Name | 3-[2-[3,3-bis(hydroxymethyl)octoxy]-5-[2-ethyl-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(C4CCC(C)CC4)cc3)cc2CC)ccc1OCCC(CO)(CO)CCCCC |
| InChI | InChI=1S/C44H60O5/c1-6-8-9-24-44(30-45,31-46)25-27-48-42-23-21-39(29-40(42)11-10-26-49-43(47)32(3)4)41-22-20-38(28-34(41)7-2)37-18-16-36(17-19-37)35-14-12-33(5)13-15-35/h16-23,28-29,33,35,45-46H,3,6-15,24-27,30-31H2,1-2,4-5H3 |
| InChIKey | SGWDHTUWKSNCLQ-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.96 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|