C52H75FO5 — CID 139377892
2-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[4-[4-(4-dodecan-4-ylcyclohexyl)-2-fluorophenyl]-2-ethylphenyl]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 139377892) has the molecular formula C52H75FO5 and a molecular weight of 799.16 g/mol. Its IUPAC name is 2-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[4-[4-(4-dodecan-4-ylcyclohexyl)-2-fluorophenyl]-2-ethylphenyl]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[4-[4-(4-dodecan-4-ylcyclohexyl)-2-fluorophenyl]-2-ethylphenyl]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139377892 |
| Molecular Formula | C52H75FO5 |
| Molecular Weight | 799.16 g/mol |
| Exact Mass | 798.56 |
| IUPAC Name | 2-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[4-[4-(4-dodecan-4-ylcyclohexyl)-2-fluorophenyl]-2-ethylphenyl]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(-c2ccc(-c3ccc(C4CCC(C(CCC)CCCCCCCC)CC4)cc3F)cc2CC)ccc1OCCC(CO)(CO)CCC |
| InChI | InChI=1S/C52H75FO5/c1-7-11-12-13-14-15-17-40(16-8-2)41-18-20-42(21-19-41)43-22-26-48(49(53)35-43)45-23-25-47(39(10-4)33-45)44-24-27-50(46(34-44)28-31-58-51(56)38(5)6)57-32-30-52(36-54,37-55)29-9-3/h22-27,33-35,40-42,54-55H,5,7-21,28-32,36-37H2,1-4,6H3 |
| InChIKey | KLVHYIFPSPESOX-UHFFFAOYSA-N |
| XLogP | 13.36 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.16 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|