C48H65FO5 — CID 139377629
2-[5-[2-ethyl-4-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 139377629) has the molecular formula C48H65FO5 and a molecular weight of 741.04 g/mol. Its IUPAC name is 2-[5-[2-ethyl-4-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-[2-ethyl-4-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139377629 |
| Molecular Formula | C48H65FO5 |
| Molecular Weight | 741.04 g/mol |
| Exact Mass | 740.48 |
| IUPAC Name | 2-[5-[2-ethyl-4-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(-c2ccc(-c3ccc(C4CCC(C5CCC(CCCCC)CC5)CC4)cc3F)cc2CC)ccc1OCCC(CO)CO |
| InChI | InChI=1S/C48H65FO5/c1-5-7-8-9-34-10-12-37(13-11-34)38-14-16-39(17-15-38)40-18-22-45(46(49)30-40)42-19-21-44(36(6-2)28-42)41-20-23-47(53-26-24-35(31-50)32-51)43(29-41)25-27-54-48(52)33(3)4/h18-23,28-30,34-35,37-39,50-51H,3,5-17,24-27,31-32H2,1-2,4H3 |
| InChIKey | LSWXWCTZTLMMBB-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.04 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|