C42H56O5 — CID 138735535
2-[5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 138735535) has the molecular formula C42H56O5 and a molecular weight of 640.90 g/mol. Its IUPAC name is 2-[5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138735535 |
| Molecular Formula | C42H56O5 |
| Molecular Weight | 640.90 g/mol |
| Exact Mass | 640.41 |
| IUPAC Name | 2-[5-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(-c2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3)cc2CC)ccc1OCCC(CO)CO |
| InChI | InChI=1S/C42H56O5/c1-5-7-8-9-31-10-12-34(13-11-31)35-14-16-36(17-15-35)37-18-20-40(33(6-2)26-37)38-19-21-41(46-24-22-32(28-43)29-44)39(27-38)23-25-47-42(45)30(3)4/h14-21,26-27,31-32,34,43-44H,3,5-13,22-25,28-29H2,1-2,4H3 |
| InChIKey | JLGMBRDGSNWZNY-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.90 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|