C43H58O5 — CID 163298280
3-[2-[2,2-bis(hydroxymethyl)butoxy]-5-[4-[4-(4-butylcyclohexyl)phenyl]-2-ethylphenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 163298280) has the molecular formula C43H58O5 and a molecular weight of 654.93 g/mol. Its IUPAC name is 3-[2-[2,2-bis(hydroxymethyl)butoxy]-5-[4-[4-(4-butylcyclohexyl)phenyl]-2-ethylphenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[2,2-bis(hydroxymethyl)butoxy]-5-[4-[4-(4-butylcyclohexyl)phenyl]-2-ethylphenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163298280 |
| Molecular Formula | C43H58O5 |
| Molecular Weight | 654.93 g/mol |
| Exact Mass | 654.43 |
| IUPAC Name | 3-[2-[2,2-bis(hydroxymethyl)butoxy]-5-[4-[4-(4-butylcyclohexyl)phenyl]-2-ethylphenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(C4CCC(CCCC)CC4)cc3)cc2CC)ccc1OCC(CC)(CO)CO |
| InChI | InChI=1S/C43H58O5/c1-6-9-11-32-13-15-34(16-14-32)35-17-19-36(20-18-35)37-21-23-40(33(7-2)26-37)38-22-24-41(48-30-43(8-3,28-44)29-45)39(27-38)12-10-25-47-42(46)31(4)5/h17-24,26-27,32,34,44-45H,4,6-16,25,28-30H2,1-3,5H3 |
| InChIKey | RWMWSDDPUNJTFH-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.93 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|