C46H66O8 — CID 155156930
[2-[[5-ethyl-2-[3-(2-oxopropanoyloxy)propyl]-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenoxy]methyl]-3-hydroxy-2-(hydroxymethyl)propyl] 2-methylprop-2-enoate (PubChem CID 155156930) has the molecular formula C46H66O8 and a molecular weight of 747.03 g/mol. Its IUPAC name is [2-[[5-ethyl-2-[3-(2-oxopropanoyloxy)propyl]-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenoxy]methyl]-3-hydroxy-2-(hydroxymethyl)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[5-ethyl-2-[3-(2-oxopropanoyloxy)propyl]-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenoxy]methyl]-3-hydroxy-2-(hydroxymethyl)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155156930 |
| Molecular Formula | C46H66O8 |
| Molecular Weight | 747.03 g/mol |
| Exact Mass | 746.48 |
| IUPAC Name | [2-[[5-ethyl-2-[3-(2-oxopropanoyloxy)propyl]-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenoxy]methyl]-3-hydroxy-2-(hydroxymethyl)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)(CO)COc1cc(CC)c(-c2ccc(C3CCC(C4CCC(CCCCC)CC4)CC3)cc2)cc1CCCOC(=O)C(C)=O |
| InChI | InChI=1S/C46H66O8/c1-6-8-9-11-34-13-15-36(16-14-34)37-17-19-38(20-18-37)39-21-23-40(24-22-39)42-26-41(12-10-25-52-45(51)33(5)49)43(27-35(42)7-2)53-30-46(28-47,29-48)31-54-44(50)32(3)4/h21-24,26-27,34,36-38,47-48H,3,6-20,25,28-31H2,1-2,4-5H3 |
| InChIKey | JRGZGKSPINSVCI-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.03 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|