C37H54O4 — CID 134193477
3-[5-[2-ethyl-4-(4-pentylcyclohexyl)phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 134193477) has the molecular formula C37H54O4 and a molecular weight of 562.84 g/mol. Its IUPAC name is 3-[5-[2-ethyl-4-(4-pentylcyclohexyl)phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-[2-ethyl-4-(4-pentylcyclohexyl)phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193477 |
| Molecular Formula | C37H54O4 |
| Molecular Weight | 562.84 g/mol |
| Exact Mass | 562.40 |
| IUPAC Name | 3-[5-[2-ethyl-4-(4-pentylcyclohexyl)phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(C3CCC(CCCCC)CC3)cc2CC)ccc1CCC(CO)CO |
| InChI | InChI=1S/C37H54O4/c1-5-7-8-10-28-12-15-31(16-13-28)34-20-21-36(30(6-2)23-34)35-19-18-32(17-14-29(25-38)26-39)33(24-35)11-9-22-41-37(40)27(3)4/h18-21,23-24,28-29,31,38-39H,3,5-17,22,25-26H2,1-2,4H3 |
| InChIKey | JUNJQENDIMIGEO-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.84 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|