C39H54O4 — CID 135139286
3-[5-[4-(4-butylcyclohexyl)-2-ethylphenyl]-2-methyl-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 135139286) has the molecular formula C39H54O4 and a molecular weight of 586.86 g/mol. Its IUPAC name is 3-[5-[4-(4-butylcyclohexyl)-2-ethylphenyl]-2-methyl-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-[4-(4-butylcyclohexyl)-2-ethylphenyl]-2-methyl-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 135139286 |
| Molecular Formula | C39H54O4 |
| Molecular Weight | 586.86 g/mol |
| Exact Mass | 586.40 |
| IUPAC Name | 3-[5-[4-(4-butylcyclohexyl)-2-ethylphenyl]-2-methyl-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(C3CCC(CCCC)CC3)cc2CC)cc(CCCOC(=O)C(=C)C)c1C |
| InChI | InChI=1S/C39H54O4/c1-8-10-13-30-16-18-32(19-17-30)35-20-21-37(31(9-2)24-35)36-25-33(14-11-22-42-38(40)27(3)4)29(7)34(26-36)15-12-23-43-39(41)28(5)6/h20-21,24-26,30,32H,3,5,8-19,22-23H2,1-2,4,6-7H3 |
| InChIKey | VVJONTCWYMWYAO-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.86 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|