C48H64O7 — CID 138718439
3-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[4-(4-cyclohexylphenyl)-2-ethylphenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 138718439) has the molecular formula C48H64O7 and a molecular weight of 753.03 g/mol. Its IUPAC name is 3-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[4-(4-cyclohexylphenyl)-2-ethylphenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[4-(4-cyclohexylphenyl)-2-ethylphenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138718439 |
| Molecular Formula | C48H64O7 |
| Molecular Weight | 753.03 g/mol |
| Exact Mass | 752.47 |
| IUPAC Name | 3-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[4-(4-cyclohexylphenyl)-2-ethylphenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(C4CCCCC4)cc3)cc2CC)cc(CCCOC(=O)C(=C)C)c1OCCC(CO)(CO)CCC |
| InChI | InChI=1S/C48H64O7/c1-7-24-48(32-49,33-50)25-28-53-45-41(16-12-26-54-46(51)34(3)4)30-43(31-42(45)17-13-27-55-47(52)35(5)6)44-23-22-40(29-36(44)8-2)39-20-18-38(19-21-39)37-14-10-9-11-15-37/h18-23,29-31,37,49-50H,3,5,7-17,24-28,32-33H2,1-2,4,6H3 |
| InChIKey | LVOYWTLRAQIJRY-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.03 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|