C32H48O7 — CID 134193181
2-[2-(3-hydroxypropyl)-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-(4-pentylcyclohexyl)phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 134193181) has the molecular formula C32H48O7 and a molecular weight of 544.73 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropyl)-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-(4-pentylcyclohexyl)phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(3-hydroxypropyl)-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-(4-pentylcyclohexyl)phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193181 |
| Molecular Formula | C32H48O7 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | 2-[2-(3-hydroxypropyl)-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-(4-pentylcyclohexyl)phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(C2CCC(CCCCC)CC2)cc(OCCOC(=O)C(=C)C)c1CCCO |
| InChI | InChI=1S/C32H48O7/c1-6-7-8-10-25-12-14-26(15-13-25)27-21-29(36-17-19-38-31(34)23(2)3)28(11-9-16-33)30(22-27)37-18-20-39-32(35)24(4)5/h21-22,25-26,33H,2,4,6-20H2,1,3,5H3 |
| InChIKey | XQTSTKORSOOGDZ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|