C34H46O7 — CID 163497687
2-[2-(3-hydroxypropyl)-5-[4-(4-methylcyclohexyl)phenyl]-3-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylpropanoate (PubChem CID 163497687) has the molecular formula C34H46O7 and a molecular weight of 566.74 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropyl)-5-[4-(4-methylcyclohexyl)phenyl]-3-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylpropanoate.
| Compound Name | 2-[2-(3-hydroxypropyl)-5-[4-(4-methylcyclohexyl)phenyl]-3-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 163497687 |
| Molecular Formula | C34H46O7 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.32 |
| IUPAC Name | 2-[2-(3-hydroxypropyl)-5-[4-(4-methylcyclohexyl)phenyl]-3-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(-c2ccc(C3CCC(C)CC3)cc2)cc(OCCOC(=O)C(C)C)c1CCCO |
| InChI | InChI=1S/C34H46O7/c1-23(2)33(36)40-19-17-38-31-21-29(28-14-12-27(13-15-28)26-10-8-25(5)9-11-26)22-32(30(31)7-6-16-35)39-18-20-41-34(37)24(3)4/h12-15,21-22,24-26,35H,1,6-11,16-20H2,2-5H3 |
| InChIKey | CSCJFVIIBUJWGZ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|