C40H48O7 — CID 145122876
2-[2-[4-(3-hydroxypropyl)phenyl]-5-[4-(4-methylcyclohexyl)phenyl]-3-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 145122876) has the molecular formula C40H48O7 and a molecular weight of 640.82 g/mol. Its IUPAC name is 2-[2-[4-(3-hydroxypropyl)phenyl]-5-[4-(4-methylcyclohexyl)phenyl]-3-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[4-(3-hydroxypropyl)phenyl]-5-[4-(4-methylcyclohexyl)phenyl]-3-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145122876 |
| Molecular Formula | C40H48O7 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | 2-[2-[4-(3-hydroxypropyl)phenyl]-5-[4-(4-methylcyclohexyl)phenyl]-3-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(-c2ccc(C3CCC(C)CC3)cc2)cc(OCCOC(=O)C(=C)C)c1-c1ccc(CCCO)cc1 |
| InChI | InChI=1S/C40H48O7/c1-27(2)39(42)46-23-21-44-36-25-35(33-18-16-32(17-19-33)31-12-8-29(5)9-13-31)26-37(45-22-24-47-40(43)28(3)4)38(36)34-14-10-30(11-15-34)7-6-20-41/h10-11,14-19,25-26,29,31,41H,1,3,6-9,12-13,20-24H2,2,4-5H3 |
| InChIKey | WBNTVYMQFVLAQX-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|