C34H40O3 — CID 145122923
3-[2-(hydroxymethyl)-5-[2-methyl-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 145122923) has the molecular formula C34H40O3 and a molecular weight of 496.69 g/mol. Its IUPAC name is 3-[2-(hydroxymethyl)-5-[2-methyl-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-(hydroxymethyl)-5-[2-methyl-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145122923 |
| Molecular Formula | C34H40O3 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | 3-[2-(hydroxymethyl)-5-[2-methyl-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(C4CCC(C)CC4)cc3)cc2C)ccc1CO |
| InChI | InChI=1S/C34H40O3/c1-23(2)34(36)37-19-5-6-29-21-31(15-16-32(29)22-35)33-18-17-30(20-25(33)4)28-13-11-27(12-14-28)26-9-7-24(3)8-10-26/h11-18,20-21,24,26,35H,1,5-10,19,22H2,2-4H3 |
| InChIKey | PGBFIXJUFLQARU-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|