C33H38O3 — CID 134200914
3-[5-[4-(4-cyclohexylphenyl)-2-methylphenyl]-2-(hydroxymethyl)phenyl]propyl 2-methylprop-2-enoate (PubChem CID 134200914) has the molecular formula C33H38O3 and a molecular weight of 482.66 g/mol. Its IUPAC name is 3-[5-[4-(4-cyclohexylphenyl)-2-methylphenyl]-2-(hydroxymethyl)phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-[4-(4-cyclohexylphenyl)-2-methylphenyl]-2-(hydroxymethyl)phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134200914 |
| Molecular Formula | C33H38O3 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 3-[5-[4-(4-cyclohexylphenyl)-2-methylphenyl]-2-(hydroxymethyl)phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(C4CCCCC4)cc3)cc2C)ccc1CO |
| InChI | InChI=1S/C33H38O3/c1-23(2)33(35)36-19-7-10-28-21-30(15-16-31(28)22-34)32-18-17-29(20-24(32)3)27-13-11-26(12-14-27)25-8-5-4-6-9-25/h11-18,20-21,25,34H,1,4-10,19,22H2,2-3H3 |
| InChIKey | JOJBTPOHRJEBPZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|