C32H36O3 — CID 134201033
[2-[4-(4-cyclohexylphenyl)-3-methylphenyl]-5-(2-hydroxyethyl)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 134201033) has the molecular formula C32H36O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is [2-[4-(4-cyclohexylphenyl)-3-methylphenyl]-5-(2-hydroxyethyl)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [2-[4-(4-cyclohexylphenyl)-3-methylphenyl]-5-(2-hydroxyethyl)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134201033 |
| Molecular Formula | C32H36O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | [2-[4-(4-cyclohexylphenyl)-3-methylphenyl]-5-(2-hydroxyethyl)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(CCO)ccc1-c1ccc(-c2ccc(C3CCCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C32H36O3/c1-22(2)32(34)35-21-29-20-24(17-18-33)9-15-31(29)28-14-16-30(23(3)19-28)27-12-10-26(11-13-27)25-7-5-4-6-8-25/h9-16,19-20,25,33H,1,4-8,17-18,21H2,2-3H3 |
| InChIKey | MFSWPAQGAFORED-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|