C32H38O3 — CID 134193297
3-[2-(hydroxymethyl)-5-[2-methyl-4-(4-pentylphenyl)phenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 134193297) has the molecular formula C32H38O3 and a molecular weight of 470.65 g/mol. Its IUPAC name is 3-[2-(hydroxymethyl)-5-[2-methyl-4-(4-pentylphenyl)phenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-(hydroxymethyl)-5-[2-methyl-4-(4-pentylphenyl)phenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193297 |
| Molecular Formula | C32H38O3 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 3-[2-(hydroxymethyl)-5-[2-methyl-4-(4-pentylphenyl)phenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(CCCCC)cc3)cc2C)ccc1CO |
| InChI | InChI=1S/C32H38O3/c1-5-6-7-9-25-11-13-26(14-12-25)28-17-18-31(24(4)20-28)29-15-16-30(22-33)27(21-29)10-8-19-35-32(34)23(2)3/h11-18,20-21,33H,2,5-10,19,22H2,1,3-4H3 |
| InChIKey | BYGLTHUIDGBUFR-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|