C31H36O3 — CID 134193727
3-[2-[3-ethyl-4-[4-(3-hydroxypropyl)phenyl]phenyl]-5-methylphenyl]propyl 2-methylprop-2-enoate (PubChem CID 134193727) has the molecular formula C31H36O3 and a molecular weight of 456.63 g/mol. Its IUPAC name is 3-[2-[3-ethyl-4-[4-(3-hydroxypropyl)phenyl]phenyl]-5-methylphenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[3-ethyl-4-[4-(3-hydroxypropyl)phenyl]phenyl]-5-methylphenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193727 |
| Molecular Formula | C31H36O3 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 3-[2-[3-ethyl-4-[4-(3-hydroxypropyl)phenyl]phenyl]-5-methylphenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(C)ccc1-c1ccc(-c2ccc(CCCO)cc2)c(CC)c1 |
| InChI | InChI=1S/C31H36O3/c1-5-25-21-28(15-17-29(25)26-13-11-24(12-14-26)8-6-18-32)30-16-10-23(4)20-27(30)9-7-19-34-31(33)22(2)3/h10-17,20-21,32H,2,5-9,18-19H2,1,3-4H3 |
| InChIKey | SUXURSCBURZFSR-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|