C31H36O4 — CID 118699985
2-[4-[3-ethyl-4-[2-ethyl-4-(3-hydroxypropyl)phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 118699985) has the molecular formula C31H36O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is 2-[4-[3-ethyl-4-[2-ethyl-4-(3-hydroxypropyl)phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[3-ethyl-4-[2-ethyl-4-(3-hydroxypropyl)phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118699985 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 2-[4-[3-ethyl-4-[2-ethyl-4-(3-hydroxypropyl)phenyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2ccc(-c3ccc(CCCO)cc3CC)c(CC)c2)cc1 |
| InChI | InChI=1S/C31H36O4/c1-5-24-20-23(8-7-17-32)9-15-29(24)30-16-12-27(21-25(30)6-2)26-10-13-28(14-11-26)34-18-19-35-31(33)22(3)4/h9-16,20-21,32H,3,5-8,17-19H2,1-2,4H3 |
| InChIKey | HCKJNTKHYDIWCS-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|