C33H37FO6 — CID 146589549
2-[6-[2-ethyl-4-(3-hydroxypropyl)phenyl]-2-fluoro-3-[4-(3-formyloxypropyl)phenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 146589549) has the molecular formula C33H37FO6 and a molecular weight of 548.65 g/mol. Its IUPAC name is 2-[6-[2-ethyl-4-(3-hydroxypropyl)phenyl]-2-fluoro-3-[4-(3-formyloxypropyl)phenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[6-[2-ethyl-4-(3-hydroxypropyl)phenyl]-2-fluoro-3-[4-(3-formyloxypropyl)phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146589549 |
| Molecular Formula | C33H37FO6 |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | 2-[6-[2-ethyl-4-(3-hydroxypropyl)phenyl]-2-fluoro-3-[4-(3-formyloxypropyl)phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1c(-c2ccc(CCCO)cc2CC)ccc(-c2ccc(CCCOC=O)cc2)c1F |
| InChI | InChI=1S/C33H37FO6/c1-4-26-21-25(7-5-17-35)11-14-28(26)30-16-15-29(27-12-9-24(10-13-27)8-6-18-38-22-36)31(34)32(30)39-19-20-40-33(37)23(2)3/h9-16,21-22,35H,2,4-8,17-20H2,1,3H3 |
| InChIKey | ZUVQFUURQRPZAG-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|