C46H58O9 — CID 118360634
3-[4-[3-ethyl-4-[4-[4-hydroxy-3-(hydroxymethyl)butoxy]-3,5-bis[3-(2-methylprop-2-enoyloxy)propyl]phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 118360634) has the molecular formula C46H58O9 and a molecular weight of 754.96 g/mol. Its IUPAC name is 3-[4-[3-ethyl-4-[4-[4-hydroxy-3-(hydroxymethyl)butoxy]-3,5-bis[3-(2-methylprop-2-enoyloxy)propyl]phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-[3-ethyl-4-[4-[4-hydroxy-3-(hydroxymethyl)butoxy]-3,5-bis[3-(2-methylprop-2-enoyloxy)propyl]phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118360634 |
| Molecular Formula | C46H58O9 |
| Molecular Weight | 754.96 g/mol |
| Exact Mass | 754.41 |
| IUPAC Name | 3-[4-[3-ethyl-4-[4-[4-hydroxy-3-(hydroxymethyl)butoxy]-3,5-bis[3-(2-methylprop-2-enoyloxy)propyl]phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1ccc(-c2ccc(-c3cc(CCCOC(=O)C(=C)C)c(OCCC(CO)CO)c(CCCOC(=O)C(=C)C)c3)c(CC)c2)cc1 |
| InChI | InChI=1S/C46H58O9/c1-8-36-26-38(37-17-15-34(16-18-37)12-9-22-53-44(49)31(2)3)19-20-42(36)41-27-39(13-10-23-54-45(50)32(4)5)43(52-25-21-35(29-47)30-48)40(28-41)14-11-24-55-46(51)33(6)7/h15-20,26-28,35,47-48H,2,4,6,8-14,21-25,29-30H2,1,3,5,7H3 |
| InChIKey | WSPWVNDQQGUCPR-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.96 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|