C43H58O7 — CID 139377890
3-[5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]-3-(3-propanoyloxypropyl)phenyl]propyl 2-methylprop-2-enoate (PubChem CID 139377890) has the molecular formula C43H58O7 and a molecular weight of 686.93 g/mol. Its IUPAC name is 3-[5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]-3-(3-propanoyloxypropyl)phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]-3-(3-propanoyloxypropyl)phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139377890 |
| Molecular Formula | C43H58O7 |
| Molecular Weight | 686.93 g/mol |
| Exact Mass | 686.42 |
| IUPAC Name | 3-[5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]-3-(3-propanoyloxypropyl)phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(CCCCC)cc3)cc2CC)cc(CCCOC(=O)CC)c1OCCC(CO)CO |
| InChI | InChI=1S/C43H58O7/c1-6-9-10-13-32-16-18-35(19-17-32)36-20-21-40(34(7-2)26-36)39-27-37(14-11-23-48-41(46)8-3)42(49-25-22-33(29-44)30-45)38(28-39)15-12-24-50-43(47)31(4)5/h16-21,26-28,33,44-45H,4,6-15,22-25,29-30H2,1-3,5H3 |
| InChIKey | LBYUVTANCIHUDS-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.93 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|