C46H64O7 — CID 166651068
3-[2-[2,2-bis(hydroxymethyl)butoxy]-5-[2-ethyl-4-(4-pentylphenyl)phenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2,2-dimethylpropanoate (PubChem CID 166651068) has the molecular formula C46H64O7 and a molecular weight of 729.01 g/mol. Its IUPAC name is 3-[2-[2,2-bis(hydroxymethyl)butoxy]-5-[2-ethyl-4-(4-pentylphenyl)phenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[2-[2,2-bis(hydroxymethyl)butoxy]-5-[2-ethyl-4-(4-pentylphenyl)phenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 166651068 |
| Molecular Formula | C46H64O7 |
| Molecular Weight | 729.01 g/mol |
| Exact Mass | 728.47 |
| IUPAC Name | 3-[2-[2,2-bis(hydroxymethyl)butoxy]-5-[2-ethyl-4-(4-pentylphenyl)phenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(CCCCC)cc3)cc2CC)cc(CCCOC(=O)C(C)(C)C)c1OCC(CC)(CO)CO |
| InChI | InChI=1S/C46H64O7/c1-9-12-13-16-34-19-21-36(22-20-34)37-23-24-41(35(10-2)27-37)40-28-38(17-14-25-51-43(49)33(4)5)42(53-32-46(11-3,30-47)31-48)39(29-40)18-15-26-52-44(50)45(6,7)8/h19-24,27-29,47-48H,4,9-18,25-26,30-32H2,1-3,5-8H3 |
| InChIKey | IHURMTDXZKYAQC-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.01 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|