C45H60O6 — CID 167602681
3-[5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[3-(hydroxymethyl)pentoxy]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 167602681) has the molecular formula C45H60O6 and a molecular weight of 696.97 g/mol. Its IUPAC name is 3-[5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[3-(hydroxymethyl)pentoxy]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[3-(hydroxymethyl)pentoxy]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 167602681 |
| Molecular Formula | C45H60O6 |
| Molecular Weight | 696.97 g/mol |
| Exact Mass | 696.44 |
| IUPAC Name | 3-[5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[3-(hydroxymethyl)pentoxy]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(CCCCC)cc3)cc2CC)cc(CCCOC(=O)C(=C)C)c1OCCC(CC)CO |
| InChI | InChI=1S/C45H60O6/c1-8-11-12-15-35-18-20-37(21-19-35)38-22-23-42(36(10-3)28-38)41-29-39(16-13-25-50-44(47)32(4)5)43(49-27-24-34(9-2)31-46)40(30-41)17-14-26-51-45(48)33(6)7/h18-23,28-30,34,46H,4,6,8-17,24-27,31H2,1-3,5,7H3 |
| InChIKey | JYLMBQYZERXBLI-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.97 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|