C40H54O5 — CID 146589223
2-[5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[4-hydroxy-3-(hydroxymethyl)-5,5-dimethylhexoxy]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 146589223) has the molecular formula C40H54O5 and a molecular weight of 614.87 g/mol. Its IUPAC name is 2-[5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[4-hydroxy-3-(hydroxymethyl)-5,5-dimethylhexoxy]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[4-hydroxy-3-(hydroxymethyl)-5,5-dimethylhexoxy]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146589223 |
| Molecular Formula | C40H54O5 |
| Molecular Weight | 614.87 g/mol |
| Exact Mass | 614.40 |
| IUPAC Name | 2-[5-[2-ethyl-4-(4-pentylphenyl)phenyl]-2-[4-hydroxy-3-(hydroxymethyl)-5,5-dimethylhexoxy]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(-c2ccc(-c3ccc(CCCCC)cc3)cc2CC)ccc1OCCC(CO)C(O)C(C)(C)C |
| InChI | InChI=1S/C40H54O5/c1-8-10-11-12-29-13-15-31(16-14-29)32-17-19-36(30(9-2)25-32)33-18-20-37(34(26-33)21-24-45-39(43)28(3)4)44-23-22-35(27-41)38(42)40(5,6)7/h13-20,25-26,35,38,41-42H,3,8-12,21-24,27H2,1-2,4-7H3 |
| InChIKey | WEDSMMQPSUATKD-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.87 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|