C40H49IO7 — CID 163673285
3-[4-[3-ethyl-4-[4-[3-iodo-4-methoxy-3-(methoxymethyl)butoxy]-3-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 163673285) has the molecular formula C40H49IO7 and a molecular weight of 768.73 g/mol. Its IUPAC name is 3-[4-[3-ethyl-4-[4-[3-iodo-4-methoxy-3-(methoxymethyl)butoxy]-3-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-[3-ethyl-4-[4-[3-iodo-4-methoxy-3-(methoxymethyl)butoxy]-3-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163673285 |
| Molecular Formula | C40H49IO7 |
| Molecular Weight | 768.73 g/mol |
| Exact Mass | 768.25 |
| IUPAC Name | 3-[4-[3-ethyl-4-[4-[3-iodo-4-methoxy-3-(methoxymethyl)butoxy]-3-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1ccc(-c2ccc(-c3ccc(OCCC(I)(COC)COC)c(CCOC(=O)C(=C)C)c3)c(CC)c2)cc1 |
| InChI | InChI=1S/C40H49IO7/c1-8-31-24-33(32-13-11-30(12-14-32)10-9-21-47-38(42)28(2)3)15-17-36(31)34-16-18-37(35(25-34)19-22-48-39(43)29(4)5)46-23-20-40(41,26-44-6)27-45-7/h11-18,24-25H,2,4,8-10,19-23,26-27H2,1,3,5-7H3 |
| InChIKey | RDPRKNARLCTLOX-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.73 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|