C33H40O5 — CID 138735749
3-[2-[4-hydroxy-3-(hydroxymethyl)-3-methylbutoxy]-5-[2-methyl-4-(4-methylphenyl)phenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 138735749) has the molecular formula C33H40O5 and a molecular weight of 516.68 g/mol. Its IUPAC name is 3-[2-[4-hydroxy-3-(hydroxymethyl)-3-methylbutoxy]-5-[2-methyl-4-(4-methylphenyl)phenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[4-hydroxy-3-(hydroxymethyl)-3-methylbutoxy]-5-[2-methyl-4-(4-methylphenyl)phenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138735749 |
| Molecular Formula | C33H40O5 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 3-[2-[4-hydroxy-3-(hydroxymethyl)-3-methylbutoxy]-5-[2-methyl-4-(4-methylphenyl)phenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(C)cc3)cc2C)ccc1OCCC(C)(CO)CO |
| InChI | InChI=1S/C33H40O5/c1-23(2)32(36)38-17-6-7-29-20-28(13-15-31(29)37-18-16-33(5,21-34)22-35)30-14-12-27(19-25(30)4)26-10-8-24(3)9-11-26/h8-15,19-20,34-35H,1,6-7,16-18,21-22H2,2-5H3 |
| InChIKey | GMJJDFZRDKVIQQ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|