C35H44O5 — CID 138735422
3-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[2-methyl-4-(4-methylphenyl)phenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 138735422) has the molecular formula C35H44O5 and a molecular weight of 544.73 g/mol. Its IUPAC name is 3-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[2-methyl-4-(4-methylphenyl)phenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[2-methyl-4-(4-methylphenyl)phenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138735422 |
| Molecular Formula | C35H44O5 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | 3-[2-[3,3-bis(hydroxymethyl)hexoxy]-5-[2-methyl-4-(4-methylphenyl)phenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(C)cc3)cc2C)ccc1OCCC(CO)(CO)CCC |
| InChI | InChI=1S/C35H44O5/c1-6-17-35(23-36,24-37)18-20-39-33-16-14-30(22-31(33)8-7-19-40-34(38)25(2)3)32-15-13-29(21-27(32)5)28-11-9-26(4)10-12-28/h9-16,21-22,36-37H,2,6-8,17-20,23-24H2,1,3-5H3 |
| InChIKey | YHISBFSZBUVFJY-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|