C44H53FO5 — CID 126700924
3-[5-[2-ethyl-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)-3-methylbutoxy]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 126700924) has the molecular formula C44H53FO5 and a molecular weight of 680.90 g/mol. Its IUPAC name is 3-[5-[2-ethyl-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)-3-methylbutoxy]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-[2-ethyl-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)-3-methylbutoxy]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126700924 |
| Molecular Formula | C44H53FO5 |
| Molecular Weight | 680.90 g/mol |
| Exact Mass | 680.39 |
| IUPAC Name | 3-[5-[2-ethyl-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)-3-methylbutoxy]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(-c4ccc(CCCCC)cc4)cc3F)cc2CC)ccc1OCCC(C)(CO)CO |
| InChI | InChI=1S/C44H53FO5/c1-6-8-9-11-32-13-15-34(16-14-32)35-17-21-40(41(45)28-35)37-18-20-39(33(7-2)26-37)36-19-22-42(49-25-23-44(5,29-46)30-47)38(27-36)12-10-24-50-43(48)31(3)4/h13-22,26-28,46-47H,3,6-12,23-25,29-30H2,1-2,4-5H3 |
| InChIKey | HSTAJOIMGGUKDD-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.90 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|