C44H58O8 — CID 146589268
2-[2-[4-[4-hydroxy-3-(hydroxymethyl)-3-methylbutoxy]-3-[2-(3-prop-1-en-2-yloxiran-2-yl)oxyethyl]phenyl]-5-[2-(4-pentylphenyl)ethyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 146589268) has the molecular formula C44H58O8 and a molecular weight of 714.94 g/mol. Its IUPAC name is 2-[2-[4-[4-hydroxy-3-(hydroxymethyl)-3-methylbutoxy]-3-[2-(3-prop-1-en-2-yloxiran-2-yl)oxyethyl]phenyl]-5-[2-(4-pentylphenyl)ethyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[4-[4-hydroxy-3-(hydroxymethyl)-3-methylbutoxy]-3-[2-(3-prop-1-en-2-yloxiran-2-yl)oxyethyl]phenyl]-5-[2-(4-pentylphenyl)ethyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146589268 |
| Molecular Formula | C44H58O8 |
| Molecular Weight | 714.94 g/mol |
| Exact Mass | 714.41 |
| IUPAC Name | 2-[2-[4-[4-hydroxy-3-(hydroxymethyl)-3-methylbutoxy]-3-[2-(3-prop-1-en-2-yloxiran-2-yl)oxyethyl]phenyl]-5-[2-(4-pentylphenyl)ethyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(CCc2ccc(CCCCC)cc2)ccc1-c1ccc(OCCC(C)(CO)CO)c(CCOC2OC2C(=C)C)c1 |
| InChI | InChI=1S/C44H58O8/c1-7-8-9-10-33-11-13-34(14-12-33)15-16-35-17-19-38(40(27-35)49-25-26-50-42(47)32(4)5)36-18-20-39(48-24-22-44(6,29-45)30-46)37(28-36)21-23-51-43-41(52-43)31(2)3/h11-14,17-20,27-28,41,43,45-46H,2,4,7-10,15-16,21-26,29-30H2,1,3,5-6H3 |
| InChIKey | GJMQIQPKZBXJLI-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.94 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|