C38H50O9 — CID 139442910
2-[5-heptyl-2-[3-[2-(2-methylprop-2-enoyloxy)ethyl]-4-[2-[(2-oxo-1,3-dioxan-5-yl)methoxy]ethoxy]phenyl]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 139442910) has the molecular formula C38H50O9 and a molecular weight of 650.81 g/mol. Its IUPAC name is 2-[5-heptyl-2-[3-[2-(2-methylprop-2-enoyloxy)ethyl]-4-[2-[(2-oxo-1,3-dioxan-5-yl)methoxy]ethoxy]phenyl]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-heptyl-2-[3-[2-(2-methylprop-2-enoyloxy)ethyl]-4-[2-[(2-oxo-1,3-dioxan-5-yl)methoxy]ethoxy]phenyl]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139442910 |
| Molecular Formula | C38H50O9 |
| Molecular Weight | 650.81 g/mol |
| Exact Mass | 650.35 |
| IUPAC Name | 2-[5-heptyl-2-[3-[2-(2-methylprop-2-enoyloxy)ethyl]-4-[2-[(2-oxo-1,3-dioxan-5-yl)methoxy]ethoxy]phenyl]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(-c2ccc(CCCCCCC)cc2CCOC(=O)C(=C)C)ccc1OCCOCC1COC(=O)OC1 |
| InChI | InChI=1S/C38H50O9/c1-6-7-8-9-10-11-29-12-14-34(32(22-29)16-18-44-36(39)27(2)3)31-13-15-35(33(23-31)17-19-45-37(40)28(4)5)43-21-20-42-24-30-25-46-38(41)47-26-30/h12-15,22-23,30H,2,4,6-11,16-21,24-26H2,1,3,5H3 |
| InChIKey | YXQMBWIKYXINFN-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.81 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|