C33H43FO6 — CID 154596483
2-[5-(3-fluoro-4-nonylphenyl)-2-[(5-methyl-2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 154596483) has the molecular formula C33H43FO6 and a molecular weight of 554.70 g/mol. Its IUPAC name is 2-[5-(3-fluoro-4-nonylphenyl)-2-[(5-methyl-2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-(3-fluoro-4-nonylphenyl)-2-[(5-methyl-2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154596483 |
| Molecular Formula | C33H43FO6 |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | 2-[5-(3-fluoro-4-nonylphenyl)-2-[(5-methyl-2-oxo-1,3-dioxan-5-yl)methoxy]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(-c2ccc(CCCCCCCCC)c(F)c2)ccc1OCC1(C)COC(=O)OC1 |
| InChI | InChI=1S/C33H43FO6/c1-5-6-7-8-9-10-11-12-25-13-14-27(20-29(25)34)26-15-16-30(28(19-26)17-18-37-31(35)24(2)3)38-21-33(4)22-39-32(36)40-23-33/h13-16,19-20H,2,5-12,17-18,21-23H2,1,3-4H3 |
| InChIKey | KAERGJQQELNDKN-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.70 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|