C36H45FO8S — CID 153465184
3-[5-(3-fluoro-4-octoxyphenyl)-2-[[5-(prop-2-enoyloxymethyl)-2-sulfanylidene-1,3-dioxan-5-yl]methoxy]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 153465184) has the molecular formula C36H45FO8S and a molecular weight of 656.81 g/mol. Its IUPAC name is 3-[5-(3-fluoro-4-octoxyphenyl)-2-[[5-(prop-2-enoyloxymethyl)-2-sulfanylidene-1,3-dioxan-5-yl]methoxy]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-(3-fluoro-4-octoxyphenyl)-2-[[5-(prop-2-enoyloxymethyl)-2-sulfanylidene-1,3-dioxan-5-yl]methoxy]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153465184 |
| Molecular Formula | C36H45FO8S |
| Molecular Weight | 656.81 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | 3-[5-(3-fluoro-4-octoxyphenyl)-2-[[5-(prop-2-enoyloxymethyl)-2-sulfanylidene-1,3-dioxan-5-yl]methoxy]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCC1(COc2ccc(-c3ccc(OCCCCCCCC)c(F)c3)cc2CCCOC(=O)C(=C)C)COC(=S)OC1 |
| InChI | InChI=1S/C36H45FO8S/c1-5-7-8-9-10-11-18-40-32-17-15-28(21-30(32)37)27-14-16-31(29(20-27)13-12-19-41-34(39)26(3)4)42-22-36(23-43-33(38)6-2)24-44-35(46)45-25-36/h6,14-17,20-21H,2-3,5,7-13,18-19,22-25H2,1,4H3 |
| InChIKey | ULRKDROLAZKUDV-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.81 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|