C46H61FO10 — CID 149118057
5-[2-[2,2-bis(hydroxymethyl)-3-(2-methylprop-2-enoyloxy)propoxy]-5-[3-fluoro-4-[2-(4-octoxyphenoxy)ethoxy]phenyl]phenyl]pentyl 2-methylprop-2-enoate (PubChem CID 149118057) has the molecular formula C46H61FO10 and a molecular weight of 792.98 g/mol. Its IUPAC name is 5-[2-[2,2-bis(hydroxymethyl)-3-(2-methylprop-2-enoyloxy)propoxy]-5-[3-fluoro-4-[2-(4-octoxyphenoxy)ethoxy]phenyl]phenyl]pentyl 2-methylprop-2-enoate.
| Compound Name | 5-[2-[2,2-bis(hydroxymethyl)-3-(2-methylprop-2-enoyloxy)propoxy]-5-[3-fluoro-4-[2-(4-octoxyphenoxy)ethoxy]phenyl]phenyl]pentyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 149118057 |
| Molecular Formula | C46H61FO10 |
| Molecular Weight | 792.98 g/mol |
| Exact Mass | 792.42 |
| IUPAC Name | 5-[2-[2,2-bis(hydroxymethyl)-3-(2-methylprop-2-enoyloxy)propoxy]-5-[3-fluoro-4-[2-(4-octoxyphenoxy)ethoxy]phenyl]phenyl]pentyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCc1cc(-c2ccc(OCCOc3ccc(OCCCCCCCC)cc3)c(F)c2)ccc1OCC(CO)(CO)COC(=O)C(=C)C |
| InChI | InChI=1S/C46H61FO10/c1-6-7-8-9-10-13-24-52-39-18-20-40(21-19-39)53-26-27-54-43-23-17-37(29-41(43)47)36-16-22-42(38(28-36)15-12-11-14-25-55-44(50)34(2)3)56-32-46(30-48,31-49)33-57-45(51)35(4)5/h16-23,28-29,48-49H,2,4,6-15,24-27,30-33H2,1,3,5H3 |
| InChIKey | QYYSSOAWEWESQR-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.98 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|