C49H56N2O11 — CID 155156799
3-[2-[2,2-bis[(2-cyanoacetyl)oxymethyl]-3-(2-methylprop-2-enoyloxy)propoxy]-5-[4-[3-(4-hexylphenyl)propanoyloxy]phenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 155156799) has the molecular formula C49H56N2O11 and a molecular weight of 848.99 g/mol. Its IUPAC name is 3-[2-[2,2-bis[(2-cyanoacetyl)oxymethyl]-3-(2-methylprop-2-enoyloxy)propoxy]-5-[4-[3-(4-hexylphenyl)propanoyloxy]phenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[2,2-bis[(2-cyanoacetyl)oxymethyl]-3-(2-methylprop-2-enoyloxy)propoxy]-5-[4-[3-(4-hexylphenyl)propanoyloxy]phenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155156799 |
| Molecular Formula | C49H56N2O11 |
| Molecular Weight | 848.99 g/mol |
| Exact Mass | 848.39 |
| IUPAC Name | 3-[2-[2,2-bis[(2-cyanoacetyl)oxymethyl]-3-(2-methylprop-2-enoyloxy)propoxy]-5-[4-[3-(4-hexylphenyl)propanoyloxy]phenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(OC(=O)CCc3ccc(CCCCCC)cc3)cc2)ccc1OCC(COC(=O)CC#N)(COC(=O)CC#N)COC(=O)C(=C)C |
| InChI | InChI=1S/C49H56N2O11/c1-6-7-8-9-11-37-13-15-38(16-14-37)17-24-46(54)62-42-21-18-39(19-22-42)40-20-23-43(41(30-40)12-10-29-57-47(55)35(2)3)58-31-49(32-59-44(52)25-27-50,33-60-45(53)26-28-51)34-61-48(56)36(4)5/h13-16,18-23,30H,2,4,6-12,17,24-26,29,31-34H2,1,3,5H3 |
| InChIKey | HFGGMZDHKDNLRQ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 188.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.99 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|