C36H40O9 — CID 139442836
[2-[2,2-bis(hydroxymethyl)butoxy]-5-[4-[3-[4-(2-methylprop-2-enoyloxy)phenoxy]-3-oxopropyl]phenyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 139442836) has the molecular formula C36H40O9 and a molecular weight of 616.71 g/mol. Its IUPAC name is [2-[2,2-bis(hydroxymethyl)butoxy]-5-[4-[3-[4-(2-methylprop-2-enoyloxy)phenoxy]-3-oxopropyl]phenyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [2-[2,2-bis(hydroxymethyl)butoxy]-5-[4-[3-[4-(2-methylprop-2-enoyloxy)phenoxy]-3-oxopropyl]phenyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139442836 |
| Molecular Formula | C36H40O9 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | [2-[2,2-bis(hydroxymethyl)butoxy]-5-[4-[3-[4-(2-methylprop-2-enoyloxy)phenoxy]-3-oxopropyl]phenyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(CCC(=O)Oc3ccc(OC(=O)C(=C)C)cc3)cc2)ccc1OCC(CC)(CO)CO |
| InChI | InChI=1S/C36H40O9/c1-6-36(21-37,22-38)23-43-32-17-12-28(19-29(32)20-42-34(40)24(2)3)27-10-7-26(8-11-27)9-18-33(39)44-30-13-15-31(16-14-30)45-35(41)25(4)5/h7-8,10-17,19,37-38H,2,4,6,9,18,20-23H2,1,3,5H3 |
| InChIKey | GHLIGQWAEMSYCE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|