C36H35FO8 — CID 134529053
[4-[4-[3-[3,4-bis(2-methylprop-2-enoyloxymethyl)phenyl]propanoyloxy]-3-fluorophenyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 134529053) has the molecular formula C36H35FO8 and a molecular weight of 614.67 g/mol. Its IUPAC name is [4-[4-[3-[3,4-bis(2-methylprop-2-enoyloxymethyl)phenyl]propanoyloxy]-3-fluorophenyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[4-[3-[3,4-bis(2-methylprop-2-enoyloxymethyl)phenyl]propanoyloxy]-3-fluorophenyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134529053 |
| Molecular Formula | C36H35FO8 |
| Molecular Weight | 614.67 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | [4-[4-[3-[3,4-bis(2-methylprop-2-enoyloxymethyl)phenyl]propanoyloxy]-3-fluorophenyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1ccc(-c2ccc(OC(=O)CCc3ccc(COC(=O)C(=C)C)c(COC(=O)C(=C)C)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C36H35FO8/c1-22(2)34(39)42-19-26-8-11-27(12-9-26)28-14-15-32(31(37)18-28)45-33(38)16-10-25-7-13-29(20-43-35(40)23(3)4)30(17-25)21-44-36(41)24(5)6/h7-9,11-15,17-18H,1,3,5,10,16,19-21H2,2,4,6H3 |
| InChIKey | HUQXPZXPBBDYGH-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.67 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|