C21H19FO4 — CID 145418981
[2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 3-methylbut-3-enoate (PubChem CID 145418981) has the molecular formula C21H19FO4 and a molecular weight of 354.38 g/mol. Its IUPAC name is [2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 3-methylbut-3-enoate.
| Compound Name | [2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 3-methylbut-3-enoate |
|---|---|
| PubChem CID | 145418981 |
| Molecular Formula | C21H19FO4 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | [2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 3-methylbut-3-enoate |
| SMILES | C=C(C)CC(=O)Oc1ccc(-c2ccc(OC(=O)C(=C)C)cc2)cc1F |
| InChI | InChI=1S/C21H19FO4/c1-13(2)11-20(23)26-19-10-7-16(12-18(19)22)15-5-8-17(9-6-15)25-21(24)14(3)4/h5-10,12H,1,3,11H2,2,4H3 |
| InChIKey | AJLODBHCVQXACJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|